C12H6F20O — CID 155147348
5-(2,3,3,4,4,5,5,6,6,6-decafluorohexan-2-yloxy)-1,1,1,2,2,3,3,4,4,5-decafluorohexane (PubChem CID 155147348) has the molecular formula C12H6F20O and a molecular weight of 546.14 g/mol. Its IUPAC name is 5-(2,3,3,4,4,5,5,6,6,6-decafluorohexan-2-yloxy)-1,1,1,2,2,3,3,4,4,5-decafluorohexane.
| Compound Name | 5-(2,3,3,4,4,5,5,6,6,6-decafluorohexan-2-yloxy)-1,1,1,2,2,3,3,4,4,5-decafluorohexane |
|---|---|
| PubChem CID | 155147348 |
| Molecular Formula | C12H6F20O |
| Molecular Weight | 546.14 g/mol |
| Exact Mass | 546.01 |
| IUPAC Name | 5-(2,3,3,4,4,5,5,6,6,6-decafluorohexan-2-yloxy)-1,1,1,2,2,3,3,4,4,5-decafluorohexane |
| SMILES | CC(F)(OC(C)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H6F20O/c1-3(13,5(15,16)7(19,20)9(23,24)11(27,28)29)33-4(2,14)6(17,18)8(21,22)10(25,26)12(30,31)32/h1-2H3 |
| InChIKey | MQSOLXIZVHXGAM-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.14 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|