C11H3F21O2 — CID 173336880
1,1,2,2,3,3,4,4-octafluoro-1-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]pentane (PubChem CID 173336880) has the molecular formula C11H3F21O2 and a molecular weight of 566.10 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-1-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]pentane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-1-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]pentane |
|---|---|
| PubChem CID | 173336880 |
| Molecular Formula | C11H3F21O2 |
| Molecular Weight | 566.10 g/mol |
| Exact Mass | 565.98 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-1-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]pentane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H3F21O2/c1-2(12,13)3(14,15)5(18,19)8(25,26)33-10(29,30)11(31,32)34-9(27,28)6(20,21)4(16,17)7(22,23)24/h1H3 |
| InChIKey | OUTSZUHPWXGGMW-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.10 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|