C6H9F7 — CID 170760942
ethane;1,1,1,2,2,3,3-heptafluorobutane (PubChem CID 170760942) has the molecular formula C6H9F7 and a molecular weight of 214.12 g/mol. Its IUPAC name is ethane;1,1,1,2,2,3,3-heptafluorobutane.
| Compound Name | ethane;1,1,1,2,2,3,3-heptafluorobutane |
|---|---|
| PubChem CID | 170760942 |
| Molecular Formula | C6H9F7 |
| Molecular Weight | 214.12 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | ethane;1,1,1,2,2,3,3-heptafluorobutane |
| SMILES | CC.CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H3F7.C2H6/c1-2(5,6)3(7,8)4(9,10)11;1-2/h1H3;1-2H3 |
| InChIKey | VKYLAWIJWJZYIT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.12 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|