C9H12F10O — CID 156806365
ethane;1,1,1,3,3,4,4-heptafluoro-2-methoxy-2-(trifluoromethyl)pentane (PubChem CID 156806365) has the molecular formula C9H12F10O and a molecular weight of 326.17 g/mol. Its IUPAC name is ethane;1,1,1,3,3,4,4-heptafluoro-2-methoxy-2-(trifluoromethyl)pentane.
| Compound Name | ethane;1,1,1,3,3,4,4-heptafluoro-2-methoxy-2-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 156806365 |
| Molecular Formula | C9H12F10O |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | ethane;1,1,1,3,3,4,4-heptafluoro-2-methoxy-2-(trifluoromethyl)pentane |
| SMILES | CC.COC(C(F)(F)F)(C(F)(F)F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C7H6F10O.C2H6/c1-3(8,9)5(10,11)4(18-2,6(12,13)14)7(15,16)17;1-2/h1-2H3;1-2H3 |
| InChIKey | VHSZVQHPABZBKQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|