C7H6F10O2 — CID 90334352
1,1,1,2,3,3-hexafluoro-2-methoxy-3-(1,1,1,2-tetrafluoropropan-2-yloxy)propane (PubChem CID 90334352) has the molecular formula C7H6F10O2 and a molecular weight of 312.10 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-2-methoxy-3-(1,1,1,2-tetrafluoropropan-2-yloxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-2-methoxy-3-(1,1,1,2-tetrafluoropropan-2-yloxy)propane |
|---|---|
| PubChem CID | 90334352 |
| Molecular Formula | C7H6F10O2 |
| Molecular Weight | 312.10 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-2-methoxy-3-(1,1,1,2-tetrafluoropropan-2-yloxy)propane |
| SMILES | COC(F)(C(F)(F)F)C(F)(F)OC(C)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F10O2/c1-3(8,5(10,11)12)19-7(16,17)4(9,18-2)6(13,14)15/h1-2H3 |
| InChIKey | HTDAEPBGSNNHGI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.10 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |