C11H8F16O5S — CID 88552384
methyl 1,1,2,2-tetrafluoro-2-[(2S)-1,1,1,2,3,3-hexafluoro-3-(1,1,1,2,2,3-hexafluoropentan-3-yloxy)propan-2-yl]oxyethanesulfonate (PubChem CID 88552384) has the molecular formula C11H8F16O5S and a molecular weight of 556.22 g/mol. Its IUPAC name is methyl 1,1,2,2-tetrafluoro-2-[(2S)-1,1,1,2,3,3-hexafluoro-3-(1,1,1,2,2,3-hexafluoropentan-3-yloxy)propan-2-yl]oxyethanesulfonate.
| Compound Name | methyl 1,1,2,2-tetrafluoro-2-[(2S)-1,1,1,2,3,3-hexafluoro-3-(1,1,1,2,2,3-hexafluoropentan-3-yloxy)propan-2-yl]oxyethanesulfonate |
|---|---|
| PubChem CID | 88552384 |
| Molecular Formula | C11H8F16O5S |
| Molecular Weight | 556.22 g/mol |
| Exact Mass | 555.98 |
| IUPAC Name | methyl 1,1,2,2-tetrafluoro-2-[(2S)-1,1,1,2,3,3-hexafluoro-3-(1,1,1,2,2,3-hexafluoropentan-3-yloxy)propan-2-yl]oxyethanesulfonate |
| SMILES | CCC(F)(OC(F)(F)[C@@](F)(OC(F)(F)C(F)(F)S(=O)(=O)OC)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H8F16O5S/c1-3-4(12,5(13,14)7(16,17)18)31-9(22,23)6(15,8(19,20)21)32-10(24,25)11(26,27)33(28,29)30-2/h3H2,1-2H3/t4?,6-/m0/s1 |
| InChIKey | LMEAEDDDFWVFOM-RZKHNPSRSA-N |
| XLogP | 5.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.22 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|