C5H3F9O4S — CID 135210232
methyl 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate (PubChem CID 135210232) has the molecular formula C5H3F9O4S and a molecular weight of 330.12 g/mol. Its IUPAC name is methyl 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate.
| Compound Name | methyl 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 135210232 |
| Molecular Formula | C5H3F9O4S |
| Molecular Weight | 330.12 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | methyl 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
| SMILES | COS(=O)(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3F9O4S/c1-17-19(15,16)5(13,14)4(11,12)18-3(9,10)2(6,7)8/h1H3 |
| InChIKey | RFNLLOPGONQENT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.12 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|