C11H8F17O6P — CID 122463213
dimethyl [2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propyl] phosphate (PubChem CID 122463213) has the molecular formula C11H8F17O6P and a molecular weight of 590.12 g/mol. Its IUPAC name is dimethyl [2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propyl] phosphate.
| Compound Name | dimethyl [2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propyl] phosphate |
|---|---|
| PubChem CID | 122463213 |
| Molecular Formula | C11H8F17O6P |
| Molecular Weight | 590.12 g/mol |
| Exact Mass | 589.98 |
| IUPAC Name | dimethyl [2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propyl] phosphate |
| SMILES | COP(=O)(OC)OCC(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8F17O6P/c1-30-35(29,31-2)32-3-4(12,7(16,17)18)33-11(27,28)6(15,9(22,23)24)34-10(25,26)5(13,14)8(19,20)21/h3H2,1-2H3 |
| InChIKey | LDWPHIRQHRICLT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.12 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|