C5H4F8O2 — CID 89282246
1,1,2,2-tetrafluoro-2-(1,1,1,2-tetrafluoropropan-2-yloxy)ethanol (PubChem CID 89282246) has the molecular formula C5H4F8O2 and a molecular weight of 248.07 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(1,1,1,2-tetrafluoropropan-2-yloxy)ethanol.
| Compound Name | 1,1,2,2-tetrafluoro-2-(1,1,1,2-tetrafluoropropan-2-yloxy)ethanol |
|---|---|
| PubChem CID | 89282246 |
| Molecular Formula | C5H4F8O2 |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(1,1,1,2-tetrafluoropropan-2-yloxy)ethanol |
| SMILES | CC(F)(OC(F)(F)C(O)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H4F8O2/c1-2(6,3(7,8)9)15-5(12,13)4(10,11)14/h14H,1H3 |
| InChIKey | FYPZZLXISDCDBX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|