C5HF11O4 — CID 58913824
2-[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-1,1,2,2-tetrafluoroethanol (PubChem CID 58913824) has the molecular formula C5HF11O4 and a molecular weight of 334.04 g/mol. Its IUPAC name is 2-[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-1,1,2,2-tetrafluoroethanol.
| Compound Name | 2-[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-1,1,2,2-tetrafluoroethanol |
|---|---|
| PubChem CID | 58913824 |
| Molecular Formula | C5HF11O4 |
| Molecular Weight | 334.04 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | 2-[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-1,1,2,2-tetrafluoroethanol |
| SMILES | OC(F)(F)C(F)(F)OC(F)(F)OC(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C5HF11O4/c6-1(7,17)2(8,9)18-4(13,14)20-5(15,16)19-3(10,11)12/h17H |
| InChIKey | UQSRQNUWEZCYNE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.04 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|