C18H33F9O10Si2 — CID 174085834
4-[[2-[difluoro(trifluoromethoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]methyl]-1,7-bis(trimethoxysilyl)heptan-4-ol (PubChem CID 174085834) has the molecular formula C18H33F9O10Si2 and a molecular weight of 636.61 g/mol. Its IUPAC name is 4-[[2-[difluoro(trifluoromethoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]methyl]-1,7-bis(trimethoxysilyl)heptan-4-ol.
| Compound Name | 4-[[2-[difluoro(trifluoromethoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]methyl]-1,7-bis(trimethoxysilyl)heptan-4-ol |
|---|---|
| PubChem CID | 174085834 |
| Molecular Formula | C18H33F9O10Si2 |
| Molecular Weight | 636.61 g/mol |
| Exact Mass | 636.15 |
| IUPAC Name | 4-[[2-[difluoro(trifluoromethoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]methyl]-1,7-bis(trimethoxysilyl)heptan-4-ol |
| SMILES | CO[Si](CCCC(O)(CCC[Si](OC)(OC)OC)COC(F)(F)C(F)(F)OC(F)(F)OC(F)(F)F)(OC)OC |
| InChI | InChI=1S/C18H33F9O10Si2/c1-29-38(30-2,31-3)11-7-9-14(28,10-8-12-39(32-4,33-5)34-6)13-35-15(19,20)16(21,22)36-18(26,27)37-17(23,24)25/h28H,7-13H2,1-6H3 |
| InChIKey | SYIGSTGHVREYPT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|