C17H35F5O7Si2 — CID 160659448
6,6,8,8,8-pentafluoro-1-trimethoxysilyl-4-(3-trimethoxysilylpropyl)octan-4-ol (PubChem CID 160659448) has the molecular formula C17H35F5O7Si2 and a molecular weight of 502.62 g/mol. Its IUPAC name is 6,6,8,8,8-pentafluoro-1-trimethoxysilyl-4-(3-trimethoxysilylpropyl)octan-4-ol.
| Compound Name | 6,6,8,8,8-pentafluoro-1-trimethoxysilyl-4-(3-trimethoxysilylpropyl)octan-4-ol |
|---|---|
| PubChem CID | 160659448 |
| Molecular Formula | C17H35F5O7Si2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 6,6,8,8,8-pentafluoro-1-trimethoxysilyl-4-(3-trimethoxysilylpropyl)octan-4-ol |
| SMILES | CO[Si](CCCC(O)(CCC[Si](OC)(OC)OC)CC(F)(F)CC(F)(F)F)(OC)OC |
| InChI | InChI=1S/C17H35F5O7Si2/c1-24-30(25-2,26-3)11-7-9-15(23,13-16(18,19)14-17(20,21)22)10-8-12-31(27-4,28-5)29-6/h23H,7-14H2,1-6H3 |
| InChIKey | VGOFGUDDGIILDR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|