C15H37FO10Si3 — CID 162451503
[2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxymethyl-trimethoxysilane (PubChem CID 162451503) has the molecular formula C15H37FO10Si3 and a molecular weight of 480.71 g/mol. Its IUPAC name is [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxymethyl-trimethoxysilane.
| Compound Name | [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxymethyl-trimethoxysilane |
|---|---|
| PubChem CID | 162451503 |
| Molecular Formula | C15H37FO10Si3 |
| Molecular Weight | 480.71 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [2-fluoro-1,5-bis(trimethoxysilyl)pentan-2-yl]oxymethyl-trimethoxysilane |
| SMILES | CO[Si](CCCC(F)(C[Si](OC)(OC)OC)OC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C15H37FO10Si3/c1-17-27(18-2,19-3)12-10-11-15(16,13-28(20-4,21-5)22-6)26-14-29(23-7,24-8)25-9/h10-14H2,1-9H3 |
| InChIKey | AJMWNOAUTMVSHW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.71 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|