C10H22O4Si — CID 86093954
2,2-dimethyl-5-trimethoxysilylpentanal (PubChem CID 86093954) has the molecular formula C10H22O4Si and a molecular weight of 234.37 g/mol. Its IUPAC name is 2,2-dimethyl-5-trimethoxysilylpentanal.
| Compound Name | 2,2-dimethyl-5-trimethoxysilylpentanal |
|---|---|
| PubChem CID | 86093954 |
| Molecular Formula | C10H22O4Si |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2,2-dimethyl-5-trimethoxysilylpentanal |
| SMILES | CO[Si](CCCC(C)(C)C=O)(OC)OC |
| InChI | InChI=1S/C10H22O4Si/c1-10(2,9-11)7-6-8-15(12-3,13-4)14-5/h9H,6-8H2,1-5H3 |
| InChIKey | TZVKXIOQDZULBK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|