C44H106O19Si8 — CID 158894670
4-methyl-1,7-bis[tris(3-trimethoxysilylpropyl)silyl]heptan-4-ol (PubChem CID 158894670) has the molecular formula C44H106O19Si8 and a molecular weight of 1164.00 g/mol. Its IUPAC name is 4-methyl-1,7-bis[tris(3-trimethoxysilylpropyl)silyl]heptan-4-ol.
| Compound Name | 4-methyl-1,7-bis[tris(3-trimethoxysilylpropyl)silyl]heptan-4-ol |
|---|---|
| PubChem CID | 158894670 |
| Molecular Formula | C44H106O19Si8 |
| Molecular Weight | 1164.00 g/mol |
| Exact Mass | 1162.55 |
| IUPAC Name | 4-methyl-1,7-bis[tris(3-trimethoxysilylpropyl)silyl]heptan-4-ol |
| SMILES | CO[Si](CCC[Si](CCCC(C)(O)CCC[Si](CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C44H106O19Si8/c1-44(45,28-20-30-64(32-22-38-66(46-2,47-3)48-4,33-23-39-67(49-5,50-6)51-7)34-24-40-68(52-8,53-9)54-10)29-21-31-65(35-25-41-69(55-11,56-12)57-13,36-26-42-70(58-14,59-15)60-16)37-27-43-71(61-17,62-18)63-19/h45H,20-43H2,1-19H3 |
| InChIKey | QJFUECCSECWVJN-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1164.00 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|