C17H34O3 — CID 58097527
7-hydroxy-12-methoxy-2,2,12-trimethyltridecanal (PubChem CID 58097527) has the molecular formula C17H34O3 and a molecular weight of 286.46 g/mol. Its IUPAC name is 7-hydroxy-12-methoxy-2,2,12-trimethyltridecanal.
| Compound Name | 7-hydroxy-12-methoxy-2,2,12-trimethyltridecanal |
|---|---|
| PubChem CID | 58097527 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | 7-hydroxy-12-methoxy-2,2,12-trimethyltridecanal |
| SMILES | COC(C)(C)CCCCC(O)CCCCC(C)(C)C=O |
| InChI | InChI=1S/C17H34O3/c1-16(2,14-18)12-8-6-10-15(19)11-7-9-13-17(3,4)20-5/h14-15,19H,6-13H2,1-5H3 |
| InChIKey | OVLAUUPLFOVKLM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|