C15H32O3 — CID 88879135
10-methoxy-2,2,10-trimethylundecane-1,6-diol (PubChem CID 88879135) has the molecular formula C15H32O3 and a molecular weight of 260.42 g/mol. Its IUPAC name is 10-methoxy-2,2,10-trimethylundecane-1,6-diol.
| Compound Name | 10-methoxy-2,2,10-trimethylundecane-1,6-diol |
|---|---|
| PubChem CID | 88879135 |
| Molecular Formula | C15H32O3 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.24 |
| IUPAC Name | 10-methoxy-2,2,10-trimethylundecane-1,6-diol |
| SMILES | COC(C)(C)CCCC(O)CCCC(C)(C)CO |
| InChI | InChI=1S/C15H32O3/c1-14(2,12-16)10-6-8-13(17)9-7-11-15(3,4)18-5/h13,16-17H,6-12H2,1-5H3 |
| InChIKey | JCXPYPJIVNDLTC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |