10-methoxy-2,10-dimethylundecanoic acid

C14H28O3 — CID 138478645

IUPAC10-methoxy-2,10-dimethylundecanoic acid
SMILESCOC(C)(C)CCCCCCCC(C)C(=O)O
InChIInChI=1S/C14H28O3/c1-12(13(15)16)10-8-6-5-7-9-11-14(2,3)17-4/h12H,5-11H2,1-4H3,(H,15,16)
InChIKeyZPQCUYRWSSBBHC-UHFFFAOYSA-N
MW244.37 g/mol
LogP3.86
Rot. Bonds10

About 10-methoxy-2,10-dimethylundecanoic acid

10-methoxy-2,10-dimethylundecanoic acid (PubChem CID 138478645) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 10-methoxy-2,10-dimethylundecanoic acid.

Molecular Properties

Compound Name10-methoxy-2,10-dimethylundecanoic acid
PubChem CID138478645
Molecular FormulaC14H28O3
Molecular Weight244.37 g/mol
Exact Mass244.20
IUPAC Name10-methoxy-2,10-dimethylundecanoic acid
SMILESCOC(C)(C)CCCCCCCC(C)C(=O)O
InChIInChI=1S/C14H28O3/c1-12(13(15)16)10-8-6-5-7-9-11-14(2,3)17-4/h12H,5-11H2,1-4H3,(H,15,16)
InChIKeyZPQCUYRWSSBBHC-UHFFFAOYSA-N
XLogP3.86
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.37
LogP ≤ 53.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 10-methoxy-2,10-dimethylundecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 10-methoxy-2,10-dimethylundecanoic acid?
The IUPAC name of 10-methoxy-2,10-dimethylundecanoic acid (CID 138478645) is 10-methoxy-2,10-dimethylundecanoic acid.
What is the SMILES notation for 10-methoxy-2,10-dimethylundecanoic acid?
The canonical SMILES for 10-methoxy-2,10-dimethylundecanoic acid is COC(C)(C)CCCCCCCC(C)C(=O)O.
What is the InChIKey of 10-methoxy-2,10-dimethylundecanoic acid?
The InChIKey is ZPQCUYRWSSBBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3/c1-12(13(15)16)10-8-6-5-7-9-11-14(2,3)17-4/h12H,5-11H2,1-4H3,(H,15,16).
What are the key properties of 10-methoxy-2,10-dimethylundecanoic acid?
10-methoxy-2,10-dimethylundecanoic acid has a molecular weight of 244.37 g/mol, XLogP of 3.86, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methoxy-2,10-dimethylundecanoic acid is sourced from PubChem (CID 138478645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).