C21H40O5 — CID 58937928
methyl 14-acetyloxy-8-hydroxy-2,2,14-trimethylpentadecanoate (PubChem CID 58937928) has the molecular formula C21H40O5 and a molecular weight of 372.55 g/mol. Its IUPAC name is methyl 14-acetyloxy-8-hydroxy-2,2,14-trimethylpentadecanoate.
| Compound Name | methyl 14-acetyloxy-8-hydroxy-2,2,14-trimethylpentadecanoate |
|---|---|
| PubChem CID | 58937928 |
| Molecular Formula | C21H40O5 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | methyl 14-acetyloxy-8-hydroxy-2,2,14-trimethylpentadecanoate |
| SMILES | COC(=O)C(C)(C)CCCCCC(O)CCCCCC(C)(C)OC(C)=O |
| InChI | InChI=1S/C21H40O5/c1-17(22)26-21(4,5)16-12-8-10-14-18(23)13-9-7-11-15-20(2,3)19(24)25-6/h18,23H,7-16H2,1-6H3 |
| InChIKey | FJALAMJCRCBKPR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|