C20H38O5S — CID 150687006
7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2,3-trimethylheptanoic acid (PubChem CID 150687006) has the molecular formula C20H38O5S and a molecular weight of 390.59 g/mol. Its IUPAC name is 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2,3-trimethylheptanoic acid.
| Compound Name | 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2,3-trimethylheptanoic acid |
|---|---|
| PubChem CID | 150687006 |
| Molecular Formula | C20H38O5S |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2,3-trimethylheptanoic acid |
| SMILES | COC(=O)C(C)(C)CCCCCS(=O)CCCCC(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C20H38O5S/c1-16(20(4,5)17(21)22)12-8-11-15-26(24)14-10-7-9-13-19(2,3)18(23)25-6/h16H,7-15H2,1-6H3,(H,21,22) |
| InChIKey | JJBPCPLBNSLGEC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|