C19H36O5S — CID 18752762
7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoic acid (PubChem CID 18752762) has the molecular formula C19H36O5S and a molecular weight of 376.56 g/mol. Its IUPAC name is 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoic acid.
| Compound Name | 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 18752762 |
| Molecular Formula | C19H36O5S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 7-(7-methoxy-6,6-dimethyl-7-oxoheptyl)sulfinyl-2,2-dimethylheptanoic acid |
| SMILES | COC(=O)C(C)(C)CCCCCS(=O)CCCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C19H36O5S/c1-18(2,16(20)21)12-8-6-10-14-25(23)15-11-7-9-13-19(3,4)17(22)24-5/h6-15H2,1-5H3,(H,20,21) |
| InChIKey | IOHWQPQBXRYLKR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|