C19H36O5 — CID 59660139
dimethyl 7-hydroxy-2,2,12,12-tetramethyltridecanedioate (PubChem CID 59660139) has the molecular formula C19H36O5 and a molecular weight of 344.49 g/mol. Its IUPAC name is dimethyl 7-hydroxy-2,2,12,12-tetramethyltridecanedioate.
| Compound Name | dimethyl 7-hydroxy-2,2,12,12-tetramethyltridecanedioate |
|---|---|
| PubChem CID | 59660139 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | dimethyl 7-hydroxy-2,2,12,12-tetramethyltridecanedioate |
| SMILES | COC(=O)C(C)(C)CCCCC(O)CCCCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C19H36O5/c1-18(2,16(21)23-5)13-9-7-11-15(20)12-8-10-14-19(3,4)17(22)24-6/h15,20H,7-14H2,1-6H3 |
| InChIKey | GKFBMMLZLROHRR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|