C19H32N4O3 — CID 59660127
N,N'-dicyano-7-hydroxy-2,2,12,12-tetramethyltridecanediamide (PubChem CID 59660127) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is N,N'-dicyano-7-hydroxy-2,2,12,12-tetramethyltridecanediamide.
| Compound Name | N,N'-dicyano-7-hydroxy-2,2,12,12-tetramethyltridecanediamide |
|---|---|
| PubChem CID | 59660127 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | N,N'-dicyano-7-hydroxy-2,2,12,12-tetramethyltridecanediamide |
| SMILES | CC(C)(CCCCC(O)CCCCC(C)(C)C(=O)NC#N)C(=O)NC#N |
| InChI | InChI=1S/C19H32N4O3/c1-18(2,16(25)22-13-20)11-7-5-9-15(24)10-6-8-12-19(3,4)17(26)23-14-21/h15,24H,5-12H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | KACSDGJHSAUCSZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|