C20H36N4O2 — CID 143079876
N-cyano-N',2,2,12,12-pentamethyltridecanediamide;formonitrile (PubChem CID 143079876) has the molecular formula C20H36N4O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is N-cyano-N',2,2,12,12-pentamethyltridecanediamide;formonitrile.
| Compound Name | N-cyano-N',2,2,12,12-pentamethyltridecanediamide;formonitrile |
|---|---|
| PubChem CID | 143079876 |
| Molecular Formula | C20H36N4O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | N-cyano-N',2,2,12,12-pentamethyltridecanediamide;formonitrile |
| SMILES | C#N.CNC(=O)C(C)(C)CCCCCCCCCC(C)(C)C(=O)NC#N |
| InChI | InChI=1S/C19H35N3O2.CHN/c1-18(2,16(23)21-5)13-11-9-7-6-8-10-12-14-19(3,4)17(24)22-15-20;1-2/h6-14H2,1-5H3,(H,21,23)(H,22,24);1H |
| InChIKey | INWCBVPYRCVARS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|