C16H26N4O2S2 — CID 20633624
N-cyano-4-[2-[4-(cyanoamino)-3,3-dimethyl-4-oxobutyl]sulfanylethylsulfanyl]-2,2-dimethylbutanamide (PubChem CID 20633624) has the molecular formula C16H26N4O2S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is N-cyano-4-[2-[4-(cyanoamino)-3,3-dimethyl-4-oxobutyl]sulfanylethylsulfanyl]-2,2-dimethylbutanamide.
| Compound Name | N-cyano-4-[2-[4-(cyanoamino)-3,3-dimethyl-4-oxobutyl]sulfanylethylsulfanyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 20633624 |
| Molecular Formula | C16H26N4O2S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-cyano-4-[2-[4-(cyanoamino)-3,3-dimethyl-4-oxobutyl]sulfanylethylsulfanyl]-2,2-dimethylbutanamide |
| SMILES | CC(C)(CCSCCSCCC(C)(C)C(=O)NC#N)C(=O)NC#N |
| InChI | InChI=1S/C16H26N4O2S2/c1-15(2,13(21)19-11-17)5-7-23-9-10-24-8-6-16(3,4)14(22)20-12-18/h5-10H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | DZOQRYFZMFYKQK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|