C14H25NOS — CID 153290969
2-(3,3-dimethylbutylsulfanylmethyl)-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 153290969) has the molecular formula C14H25NOS and a molecular weight of 255.43 g/mol. Its IUPAC name is 2-(3,3-dimethylbutylsulfanylmethyl)-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | 2-(3,3-dimethylbutylsulfanylmethyl)-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 153290969 |
| Molecular Formula | C14H25NOS |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-(3,3-dimethylbutylsulfanylmethyl)-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | CC(C)(C)CCSCC(C#N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C14H25NOS/c1-13(2,3)7-8-17-10-11(9-15)12(16)14(4,5)6/h11H,7-8,10H2,1-6H3 |
| InChIKey | VFJITPFYDMGZPG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|