C14H24N2O4S — CID 65253659
3-(3-cyano-3-methylbutyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 65253659) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 3-(3-cyano-3-methylbutyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-(3-cyano-3-methylbutyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 65253659 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3-(3-cyano-3-methylbutyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C#N)CCSCC(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H24N2O4S/c1-13(2,3)20-12(19)16-10(11(17)18)8-21-7-6-14(4,5)9-15/h10H,6-8H2,1-5H3,(H,16,19)(H,17,18) |
| InChIKey | IQVACMWAMKVTER-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|