C16H28N2O4S — CID 106710674
3-(5-cyano-5-methylhexyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 106710674) has the molecular formula C16H28N2O4S and a molecular weight of 344.48 g/mol. Its IUPAC name is 3-(5-cyano-5-methylhexyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-(5-cyano-5-methylhexyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 106710674 |
| Molecular Formula | C16H28N2O4S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-(5-cyano-5-methylhexyl)sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C#N)CCCCSCC(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H28N2O4S/c1-15(2,3)22-14(21)18-12(13(19)20)10-23-9-7-6-8-16(4,5)11-17/h12H,6-10H2,1-5H3,(H,18,21)(H,19,20) |
| InChIKey | VSBHNPMYHLAWFC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|