C20H37NO3 — CID 159659971
N,2,2,12,12-pentamethyl-7,13-dioxopentadecanamide (PubChem CID 159659971) has the molecular formula C20H37NO3 and a molecular weight of 339.52 g/mol. Its IUPAC name is N,2,2,12,12-pentamethyl-7,13-dioxopentadecanamide.
| Compound Name | N,2,2,12,12-pentamethyl-7,13-dioxopentadecanamide |
|---|---|
| PubChem CID | 159659971 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | N,2,2,12,12-pentamethyl-7,13-dioxopentadecanamide |
| SMILES | CCC(=O)C(C)(C)CCCCC(=O)CCCCC(C)(C)C(=O)NC |
| InChI | InChI=1S/C20H37NO3/c1-7-17(23)19(2,3)14-10-8-12-16(22)13-9-11-15-20(4,5)18(24)21-6/h7-15H2,1-6H3,(H,21,24) |
| InChIKey | RSFSXHBGQAWWRY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|