C33H46O3 — CID 10228246
3,3,15,15-tetramethyl-1,17-diphenylheptadecane-2,9,16-trione (PubChem CID 10228246) has the molecular formula C33H46O3 and a molecular weight of 490.73 g/mol. Its IUPAC name is 3,3,15,15-tetramethyl-1,17-diphenylheptadecane-2,9,16-trione.
| Compound Name | 3,3,15,15-tetramethyl-1,17-diphenylheptadecane-2,9,16-trione |
|---|---|
| PubChem CID | 10228246 |
| Molecular Formula | C33H46O3 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.34 |
| IUPAC Name | 3,3,15,15-tetramethyl-1,17-diphenylheptadecane-2,9,16-trione |
| SMILES | CC(C)(CCCCCC(=O)CCCCCC(C)(C)C(=O)Cc1ccccc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C33H46O3/c1-32(2,30(35)25-27-17-9-5-10-18-27)23-15-7-13-21-29(34)22-14-8-16-24-33(3,4)31(36)26-28-19-11-6-12-20-28/h5-6,9-12,17-20H,7-8,13-16,21-26H2,1-4H3 |
| InChIKey | LLOMBCGFKNAOQI-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|