C19H28NO3- — CID 71431538
N-tert-butyl-N-(7-oxo-8-phenyloctyl)carbamate (PubChem CID 71431538) has the molecular formula C19H28NO3- and a molecular weight of 318.44 g/mol. Its IUPAC name is N-tert-butyl-N-(7-oxo-8-phenyloctyl)carbamate.
| Compound Name | N-tert-butyl-N-(7-oxo-8-phenyloctyl)carbamate |
|---|---|
| PubChem CID | 71431538 |
| Molecular Formula | C19H28NO3- |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-tert-butyl-N-(7-oxo-8-phenyloctyl)carbamate |
| SMILES | CC(C)(C)N(CCCCCCC(=O)Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C19H29NO3/c1-19(2,3)20(18(22)23)14-10-5-4-9-13-17(21)15-16-11-7-6-8-12-16/h6-8,11-12H,4-5,9-10,13-15H2,1-3H3,(H,22,23)/p-1 |
| InChIKey | XJDPBUGTPAMFJA-UHFFFAOYSA-M |
| XLogP | 3.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|