C31H42O5 — CID 20631202
dimethyl 2,14-dimethyl-8-oxo-2,14-diphenylpentadecanedioate (PubChem CID 20631202) has the molecular formula C31H42O5 and a molecular weight of 494.67 g/mol. Its IUPAC name is dimethyl 2,14-dimethyl-8-oxo-2,14-diphenylpentadecanedioate.
| Compound Name | dimethyl 2,14-dimethyl-8-oxo-2,14-diphenylpentadecanedioate |
|---|---|
| PubChem CID | 20631202 |
| Molecular Formula | C31H42O5 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | dimethyl 2,14-dimethyl-8-oxo-2,14-diphenylpentadecanedioate |
| SMILES | COC(=O)C(C)(CCCCCC(=O)CCCCCC(C)(C(=O)OC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H42O5/c1-30(28(33)35-3,25-17-9-5-10-18-25)23-15-7-13-21-27(32)22-14-8-16-24-31(2,29(34)36-4)26-19-11-6-12-20-26/h5-6,9-12,17-20H,7-8,13-16,21-24H2,1-4H3 |
| InChIKey | MPEMXWNNWKCMIT-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|