C27H54F6O11Si2 — CID 160629572
5-[[[1,1-difluoro-2-[2-hydroxy-5-trimethoxysilyl-2-(3-trimethoxysilylpropyl)pentoxy]ethoxy]-difluoromethoxy]-difluoromethyl]nonan-5-ol (PubChem CID 160629572) has the molecular formula C27H54F6O11Si2 and a molecular weight of 724.88 g/mol. Its IUPAC name is 5-[[[1,1-difluoro-2-[2-hydroxy-5-trimethoxysilyl-2-(3-trimethoxysilylpropyl)pentoxy]ethoxy]-difluoromethoxy]-difluoromethyl]nonan-5-ol.
| Compound Name | 5-[[[1,1-difluoro-2-[2-hydroxy-5-trimethoxysilyl-2-(3-trimethoxysilylpropyl)pentoxy]ethoxy]-difluoromethoxy]-difluoromethyl]nonan-5-ol |
|---|---|
| PubChem CID | 160629572 |
| Molecular Formula | C27H54F6O11Si2 |
| Molecular Weight | 724.88 g/mol |
| Exact Mass | 724.31 |
| IUPAC Name | 5-[[[1,1-difluoro-2-[2-hydroxy-5-trimethoxysilyl-2-(3-trimethoxysilylpropyl)pentoxy]ethoxy]-difluoromethoxy]-difluoromethyl]nonan-5-ol |
| SMILES | CCCCC(O)(CCCC)C(F)(F)OC(F)(F)OC(F)(F)COCC(O)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C27H54F6O11Si2/c1-9-11-17-24(35,18-12-10-2)26(30,31)44-27(32,33)43-25(28,29)22-42-21-23(34,15-13-19-45(36-3,37-4)38-5)16-14-20-46(39-6,40-7)41-8/h34-35H,9-22H2,1-8H3 |
| InChIKey | RHTBVJYWJYNPHQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.88 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|