C34H66F10O13Si3 — CID 174111598
[10-[2-[4-(2,2-difluoro-2-methoxyethoxy)-1,1,3,3-tetrafluorobutoxy]-2,2-difluoroethoxy]-9,9-difluoro-5,5-bis(3-trimethoxysilylpropyl)decyl]-trimethoxysilane (PubChem CID 174111598) has the molecular formula C34H66F10O13Si3 and a molecular weight of 957.13 g/mol. Its IUPAC name is [10-[2-[4-(2,2-difluoro-2-methoxyethoxy)-1,1,3,3-tetrafluorobutoxy]-2,2-difluoroethoxy]-9,9-difluoro-5,5-bis(3-trimethoxysilylpropyl)decyl]-trimethoxysilane.
| Compound Name | [10-[2-[4-(2,2-difluoro-2-methoxyethoxy)-1,1,3,3-tetrafluorobutoxy]-2,2-difluoroethoxy]-9,9-difluoro-5,5-bis(3-trimethoxysilylpropyl)decyl]-trimethoxysilane |
|---|---|
| PubChem CID | 174111598 |
| Molecular Formula | C34H66F10O13Si3 |
| Molecular Weight | 957.13 g/mol |
| Exact Mass | 956.37 |
| IUPAC Name | [10-[2-[4-(2,2-difluoro-2-methoxyethoxy)-1,1,3,3-tetrafluorobutoxy]-2,2-difluoroethoxy]-9,9-difluoro-5,5-bis(3-trimethoxysilylpropyl)decyl]-trimethoxysilane |
| SMILES | COC(F)(F)COCC(F)(F)CC(F)(F)OC(F)(F)COCC(F)(F)CCCC(CCCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C34H66F10O13Si3/c1-45-33(41,42)27-56-26-31(37,38)24-32(39,40)57-34(43,44)28-55-25-30(35,36)20-13-17-29(18-14-22-59(49-5,50-6)51-7,19-15-23-60(52-8,53-9)54-10)16-11-12-21-58(46-2,47-3)48-4/h11-28H2,1-10H3 |
| InChIKey | JMLMKVQQVUZJNP-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.13 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|