C14H20F11NO8Si — CID 153452949
2-[2-[difluoro-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]methoxy]-2,2-difluoroethoxy]-N-(3-trimethoxysilylpropyl)acetamide (PubChem CID 153452949) has the molecular formula C14H20F11NO8Si and a molecular weight of 567.38 g/mol. Its IUPAC name is 2-[2-[difluoro-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]methoxy]-2,2-difluoroethoxy]-N-(3-trimethoxysilylpropyl)acetamide.
| Compound Name | 2-[2-[difluoro-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]methoxy]-2,2-difluoroethoxy]-N-(3-trimethoxysilylpropyl)acetamide |
|---|---|
| PubChem CID | 153452949 |
| Molecular Formula | C14H20F11NO8Si |
| Molecular Weight | 567.38 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | 2-[2-[difluoro-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]methoxy]-2,2-difluoroethoxy]-N-(3-trimethoxysilylpropyl)acetamide |
| SMILES | CO[Si](CCCNC(=O)COCC(F)(F)OC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F)(OC)OC |
| InChI | InChI=1S/C14H20F11NO8Si/c1-28-35(29-2,30-3)6-4-5-26-9(27)7-31-8-10(15,16)32-14(24,25)34-12(19,20)11(17,18)33-13(21,22)23/h4-8H2,1-3H3,(H,26,27) |
| InChIKey | HROAASAIDLNQOU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|