C11H22Cl3NO5Si — CID 142604452
4,4,4-trichloro-3-hydroxy-3-methyl-N-(3-trimethoxysilylpropyl)butanamide (PubChem CID 142604452) has the molecular formula C11H22Cl3NO5Si and a molecular weight of 382.74 g/mol. Its IUPAC name is 4,4,4-trichloro-3-hydroxy-3-methyl-N-(3-trimethoxysilylpropyl)butanamide.
| Compound Name | 4,4,4-trichloro-3-hydroxy-3-methyl-N-(3-trimethoxysilylpropyl)butanamide |
|---|---|
| PubChem CID | 142604452 |
| Molecular Formula | C11H22Cl3NO5Si |
| Molecular Weight | 382.74 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 4,4,4-trichloro-3-hydroxy-3-methyl-N-(3-trimethoxysilylpropyl)butanamide |
| SMILES | CO[Si](CCCNC(=O)CC(C)(O)C(Cl)(Cl)Cl)(OC)OC |
| InChI | InChI=1S/C11H22Cl3NO5Si/c1-10(17,11(12,13)14)8-9(16)15-6-5-7-21(18-2,19-3)20-4/h17H,5-8H2,1-4H3,(H,15,16) |
| InChIKey | BSXHEVJNFVMGHG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.74 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|