C17H38N2O7Si2 — CID 174034549
N-[3-[ethyl(dimethoxy)silyl]propyl]-N'-(3-trimethoxysilylpropyl)butanediamide (PubChem CID 174034549) has the molecular formula C17H38N2O7Si2 and a molecular weight of 438.67 g/mol. Its IUPAC name is N-[3-[ethyl(dimethoxy)silyl]propyl]-N'-(3-trimethoxysilylpropyl)butanediamide.
| Compound Name | N-[3-[ethyl(dimethoxy)silyl]propyl]-N'-(3-trimethoxysilylpropyl)butanediamide |
|---|---|
| PubChem CID | 174034549 |
| Molecular Formula | C17H38N2O7Si2 |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N-[3-[ethyl(dimethoxy)silyl]propyl]-N'-(3-trimethoxysilylpropyl)butanediamide |
| SMILES | CC[Si](CCCNC(=O)CCC(=O)NCCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C17H38N2O7Si2/c1-7-27(22-2,23-3)14-8-12-18-16(20)10-11-17(21)19-13-9-15-28(24-4,25-5)26-6/h7-15H2,1-6H3,(H,18,20)(H,19,21) |
| InChIKey | MWRKANAGVLLRJJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|