C23H48N2O9Si2 — CID 174034547
[4-(3-trimethoxysilylpropylcarbamoyloxymethyl)cyclohexyl]methyl N-[3-[ethyl(dimethoxy)silyl]propyl]carbamate (PubChem CID 174034547) has the molecular formula C23H48N2O9Si2 and a molecular weight of 552.81 g/mol. Its IUPAC name is [4-(3-trimethoxysilylpropylcarbamoyloxymethyl)cyclohexyl]methyl N-[3-[ethyl(dimethoxy)silyl]propyl]carbamate.
| Compound Name | [4-(3-trimethoxysilylpropylcarbamoyloxymethyl)cyclohexyl]methyl N-[3-[ethyl(dimethoxy)silyl]propyl]carbamate |
|---|---|
| PubChem CID | 174034547 |
| Molecular Formula | C23H48N2O9Si2 |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | [4-(3-trimethoxysilylpropylcarbamoyloxymethyl)cyclohexyl]methyl N-[3-[ethyl(dimethoxy)silyl]propyl]carbamate |
| SMILES | CC[Si](CCCNC(=O)OCC1CCC(COC(=O)NCCC[Si](OC)(OC)OC)CC1)(OC)OC |
| InChI | InChI=1S/C23H48N2O9Si2/c1-7-35(28-2,29-3)16-8-14-24-22(26)33-18-20-10-12-21(13-11-20)19-34-23(27)25-15-9-17-36(30-4,31-5)32-6/h20-21H,7-19H2,1-6H3,(H,24,26)(H,25,27) |
| InChIKey | QZYHCSKTJKTXJU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|