C31H53NO6 — CID 160761209
[4-[[(E)-prop-1-enoxy]methyl]cyclohexyl]methyl 8-[[4-[[(E)-prop-1-enoxy]methyl]cyclohexyl]methoxycarbonylamino]octanoate (PubChem CID 160761209) has the molecular formula C31H53NO6 and a molecular weight of 535.77 g/mol. Its IUPAC name is [4-[[(E)-prop-1-enoxy]methyl]cyclohexyl]methyl 8-[[4-[[(E)-prop-1-enoxy]methyl]cyclohexyl]methoxycarbonylamino]octanoate.
| Compound Name | [4-[[(E)-prop-1-enoxy]methyl]cyclohexyl]methyl 8-[[4-[[(E)-prop-1-enoxy]methyl]cyclohexyl]methoxycarbonylamino]octanoate |
|---|---|
| PubChem CID | 160761209 |
| Molecular Formula | C31H53NO6 |
| Molecular Weight | 535.77 g/mol |
| Exact Mass | 535.39 |
| IUPAC Name | [4-[[(E)-prop-1-enoxy]methyl]cyclohexyl]methyl 8-[[4-[[(E)-prop-1-enoxy]methyl]cyclohexyl]methoxycarbonylamino]octanoate |
| SMILES | C/C=C/OCC1CCC(COC(=O)CCCCCCCNC(=O)OCC2CCC(CO/C=C/C)CC2)CC1 |
| InChI | InChI=1S/C31H53NO6/c1-3-20-35-22-26-11-15-28(16-12-26)24-37-30(33)10-8-6-5-7-9-19-32-31(34)38-25-29-17-13-27(14-18-29)23-36-21-4-2/h3-4,20-21,26-29H,5-19,22-25H2,1-2H3,(H,32,34)/b20-3+,21-4+ |
| InChIKey | RYCBFMRABHUHHD-CFJAUDHOSA-N |
| XLogP | 7.31 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.77 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|