About bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate
bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate (PubChem CID 101035077) has the molecular formula C27H44O6
and a molecular weight of 464.64 g/mol. Its IUPAC name is bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate.
Molecular Properties
| Compound Name | bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate |
| PubChem CID | 101035077 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate |
| SMILES | C=CCOCC1CCC(COC(=O)CCCC(=O)OCC2CCC(COCC=C)CC2)CC1 |
| InChI | InChI=1S/C27H44O6/c1-3-16-30-18-22-8-12-24(13-9-22)20-32-26(28)6-5-7-27(29)33-21-25-14-10-23(11-15-25)19-31-17-4-2/h3-4,22-25H,1-2,5-21H2 |
| InChIKey | MMSWGGFIRXWIPR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate?
The IUPAC name of bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate (CID 101035077) is bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate.
What is the SMILES notation for bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate?
The canonical SMILES for bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate is C=CCOCC1CCC(COC(=O)CCCC(=O)OCC2CCC(COCC=C)CC2)CC1.
What is the InChIKey of bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate?
The InChIKey is MMSWGGFIRXWIPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H44O6/c1-3-16-30-18-22-8-12-24(13-9-22)20-32-26(28)6-5-7-27(29)33-21-25-14-10-23(11-15-25)19-31-17-4-2/h3-4,22-25H,1-2,5-21H2.
What are the key properties of bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate?
bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate has a molecular weight of 464.64 g/mol, XLogP of 5.26, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[[4-(prop-2-enoxymethyl)cyclohexyl]methyl] pentanedioate is sourced from PubChem (CID 101035077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).