About oxan-3-ylmethyl dec-9-enoate
oxan-3-ylmethyl dec-9-enoate (PubChem CID 166684092) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is oxan-3-ylmethyl dec-9-enoate.
Molecular Properties
| Compound Name | oxan-3-ylmethyl dec-9-enoate |
| PubChem CID | 166684092 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | oxan-3-ylmethyl dec-9-enoate |
| SMILES | C=CCCCCCCCC(=O)OCC1CCCOC1 |
| InChI | InChI=1S/C16H28O3/c1-2-3-4-5-6-7-8-11-16(17)19-14-15-10-9-12-18-13-15/h2,15H,1,3-14H2 |
| InChIKey | NWTBEKGIPNNBKD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oxan-3-ylmethyl dec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-3-ylmethyl dec-9-enoate?
The IUPAC name of oxan-3-ylmethyl dec-9-enoate (CID 166684092) is oxan-3-ylmethyl dec-9-enoate.
What is the SMILES notation for oxan-3-ylmethyl dec-9-enoate?
The canonical SMILES for oxan-3-ylmethyl dec-9-enoate is C=CCCCCCCCC(=O)OCC1CCCOC1.
What is the InChIKey of oxan-3-ylmethyl dec-9-enoate?
The InChIKey is NWTBEKGIPNNBKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-2-3-4-5-6-7-8-11-16(17)19-14-15-10-9-12-18-13-15/h2,15H,1,3-14H2.
What are the key properties of oxan-3-ylmethyl dec-9-enoate?
oxan-3-ylmethyl dec-9-enoate has a molecular weight of 268.40 g/mol, XLogP of 3.87, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-3-ylmethyl dec-9-enoate is sourced from PubChem (CID 166684092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).