C17H38N2O9Si2 — CID 174034551
2-(3-trimethoxysilylpropylcarbamoyloxy)ethyl N-[3-[ethyl(dimethoxy)silyl]propyl]carbamate (PubChem CID 174034551) has the molecular formula C17H38N2O9Si2 and a molecular weight of 470.67 g/mol. Its IUPAC name is 2-(3-trimethoxysilylpropylcarbamoyloxy)ethyl N-[3-[ethyl(dimethoxy)silyl]propyl]carbamate.
| Compound Name | 2-(3-trimethoxysilylpropylcarbamoyloxy)ethyl N-[3-[ethyl(dimethoxy)silyl]propyl]carbamate |
|---|---|
| PubChem CID | 174034551 |
| Molecular Formula | C17H38N2O9Si2 |
| Molecular Weight | 470.67 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 2-(3-trimethoxysilylpropylcarbamoyloxy)ethyl N-[3-[ethyl(dimethoxy)silyl]propyl]carbamate |
| SMILES | CC[Si](CCCNC(=O)OCCOC(=O)NCCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C17H38N2O9Si2/c1-7-29(22-2,23-3)14-8-10-18-16(20)27-12-13-28-17(21)19-11-9-15-30(24-4,25-5)26-6/h7-15H2,1-6H3,(H,18,20)(H,19,21) |
| InChIKey | OOOSHGNOJZREQN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.67 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|