C13H29N3O5SSi — CID 58903441
3-methylsulfanyl-N-[2-(3-trimethoxysilylpropylcarbamoylamino)ethyl]propanamide (PubChem CID 58903441) has the molecular formula C13H29N3O5SSi and a molecular weight of 367.54 g/mol. Its IUPAC name is 3-methylsulfanyl-N-[2-(3-trimethoxysilylpropylcarbamoylamino)ethyl]propanamide.
| Compound Name | 3-methylsulfanyl-N-[2-(3-trimethoxysilylpropylcarbamoylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 58903441 |
| Molecular Formula | C13H29N3O5SSi |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3-methylsulfanyl-N-[2-(3-trimethoxysilylpropylcarbamoylamino)ethyl]propanamide |
| SMILES | CO[Si](CCCNC(=O)NCCNC(=O)CCSC)(OC)OC |
| InChI | InChI=1S/C13H29N3O5SSi/c1-19-23(20-2,21-3)11-5-7-15-13(18)16-9-8-14-12(17)6-10-22-4/h5-11H2,1-4H3,(H,14,17)(H2,15,16,18) |
| InChIKey | KCHJPSGHUXHJHC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|