C8F18O5 — CID 175196171
1-[[[[difluoro(1,1,2,2,2-pentafluoroethoxy)methoxy]-difluoromethoxy]-difluoromethoxy]-difluoromethoxy]-1,1,2,2,2-pentafluoroethane (PubChem CID 175196171) has the molecular formula C8F18O5 and a molecular weight of 518.05 g/mol. Its IUPAC name is 1-[[[[difluoro(1,1,2,2,2-pentafluoroethoxy)methoxy]-difluoromethoxy]-difluoromethoxy]-difluoromethoxy]-1,1,2,2,2-pentafluoroethane.
| Compound Name | 1-[[[[difluoro(1,1,2,2,2-pentafluoroethoxy)methoxy]-difluoromethoxy]-difluoromethoxy]-difluoromethoxy]-1,1,2,2,2-pentafluoroethane |
|---|---|
| PubChem CID | 175196171 |
| Molecular Formula | C8F18O5 |
| Molecular Weight | 518.05 g/mol |
| Exact Mass | 517.95 |
| IUPAC Name | 1-[[[[difluoro(1,1,2,2,2-pentafluoroethoxy)methoxy]-difluoromethoxy]-difluoromethoxy]-difluoromethoxy]-1,1,2,2,2-pentafluoroethane |
| SMILES | FC(F)(OC(F)(F)OC(F)(F)OC(F)(F)C(F)(F)F)OC(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8F18O5/c9-1(10,11)3(15,16)27-5(19,20)29-7(23,24)31-8(25,26)30-6(21,22)28-4(17,18)2(12,13)14 |
| InChIKey | AVENUFXISSFWDN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.05 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|