C4F10O3 — CID 141163022
1,1,1,2,2-pentafluoro-2-(1,1,2,2,2-pentafluoroethoxyperoxy)ethane (PubChem CID 141163022) has the molecular formula C4F10O3 and a molecular weight of 286.02 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-2-(1,1,2,2,2-pentafluoroethoxyperoxy)ethane.
| Compound Name | 1,1,1,2,2-pentafluoro-2-(1,1,2,2,2-pentafluoroethoxyperoxy)ethane |
|---|---|
| PubChem CID | 141163022 |
| Molecular Formula | C4F10O3 |
| Molecular Weight | 286.02 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-2-(1,1,2,2,2-pentafluoroethoxyperoxy)ethane |
| SMILES | FC(F)(F)C(F)(F)OOOC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4F10O3/c5-1(6,7)3(11,12)15-17-16-4(13,14)2(8,9)10 |
| InChIKey | IXZNOTGGYSKBTQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.02 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|