C2F10OSe — CID 14026600
1,1,1,2,2-pentafluoro-2-(pentafluoro-lambda6-selanyl)oxyethane (PubChem CID 14026600) has the molecular formula C2F10OSe and a molecular weight of 308.96 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-2-(pentafluoro-lambda6-selanyl)oxyethane.
| Compound Name | 1,1,1,2,2-pentafluoro-2-(pentafluoro-lambda6-selanyl)oxyethane |
|---|---|
| PubChem CID | 14026600 |
| Molecular Formula | C2F10OSe |
| Molecular Weight | 308.96 g/mol |
| Exact Mass | 309.90 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-2-(pentafluoro-lambda6-selanyl)oxyethane |
| SMILES | FC(F)(F)C(F)(F)O[Se](F)(F)(F)(F)F |
| InChI | InChI=1S/C2F10OSe/c3-1(4,5)2(6,7)13-14(8,9,10,11)12 |
| InChIKey | XXZFGBFIFMCOTB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.96 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|