C6H2F12O2 — CID 175740142
1-[1,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]-1,1,2,2,2-pentafluoroethane (PubChem CID 175740142) has the molecular formula C6H2F12O2 and a molecular weight of 334.06 g/mol. Its IUPAC name is 1-[1,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]-1,1,2,2,2-pentafluoroethane.
| Compound Name | 1-[1,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]-1,1,2,2,2-pentafluoroethane |
|---|---|
| PubChem CID | 175740142 |
| Molecular Formula | C6H2F12O2 |
| Molecular Weight | 334.06 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 1-[1,2-difluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]-1,1,2,2,2-pentafluoroethane |
| SMILES | FC(OC(F)(F)C(F)(F)F)C(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H2F12O2/c7-1(19-5(15,16)3(9,10)11)2(8)20-6(17,18)4(12,13)14/h1-2H |
| InChIKey | BMNMLAQWQKRYGG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.06 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|