About [2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite
[2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite (PubChem CID 88556084) has the molecular formula C4HF9O2
and a molecular weight of 252.03 g/mol. Its IUPAC name is [2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite.
Analyze [2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite?
The IUPAC name of [2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite (CID 88556084) is [2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite.
What is the SMILES notation for [2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite?
The canonical SMILES for [2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite is FOC(F)(F)C(F)(OC(F)F)C(F)(F)F.
What is the InChIKey of [2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite?
The InChIKey is OLFPCSWTHKIEKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HF9O2/c5-1(6)14-2(7,3(8,9)10)4(11,12)15-13/h1H.
What are the key properties of [2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite?
[2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite has a molecular weight of 252.03 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(difluoromethoxy)-1,1,2,3,3,3-hexafluoropropyl] hypofluorite is sourced from PubChem (CID 88556084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).