C5HClF10O2 — CID 150266243
1-chloro-1-(difluoromethoxy)-2,2,2-trifluoro-1-(1,1,2,2,2-pentafluoroethoxy)ethane (PubChem CID 150266243) has the molecular formula C5HClF10O2 and a molecular weight of 318.49 g/mol. Its IUPAC name is 1-chloro-1-(difluoromethoxy)-2,2,2-trifluoro-1-(1,1,2,2,2-pentafluoroethoxy)ethane.
| Compound Name | 1-chloro-1-(difluoromethoxy)-2,2,2-trifluoro-1-(1,1,2,2,2-pentafluoroethoxy)ethane |
|---|---|
| PubChem CID | 150266243 |
| Molecular Formula | C5HClF10O2 |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | 1-chloro-1-(difluoromethoxy)-2,2,2-trifluoro-1-(1,1,2,2,2-pentafluoroethoxy)ethane |
| SMILES | FC(F)OC(Cl)(OC(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5HClF10O2/c6-2(3(9,10)11,17-1(7)8)18-5(15,16)4(12,13)14/h1H |
| InChIKey | GCPHEOZBXXVYLL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|