C4HCl3F6O — CID 131727729
1,1,1,2,2-pentafluoro-2-(1,2,2-trichloro-2-fluoroethoxy)ethane (PubChem CID 131727729) has the molecular formula C4HCl3F6O and a molecular weight of 285.40 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-2-(1,2,2-trichloro-2-fluoroethoxy)ethane.
| Compound Name | 1,1,1,2,2-pentafluoro-2-(1,2,2-trichloro-2-fluoroethoxy)ethane |
|---|---|
| PubChem CID | 131727729 |
| Molecular Formula | C4HCl3F6O |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 283.90 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-2-(1,2,2-trichloro-2-fluoroethoxy)ethane |
| SMILES | FC(Cl)(Cl)C(Cl)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HCl3F6O/c5-1(2(6,7)8)14-4(12,13)3(9,10)11/h1H |
| InChIKey | NVTVJWPIGSYSCL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|